C23H24N6O — CID 135489341
3-[4-[(2-morpholin-4-ylethylamino)methyl]-1H-indol-2-yl]-1H-indazole-6-carbonitrile (PubChem CID 135489341) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 3-[4-[(2-morpholin-4-ylethylamino)methyl]-1H-indol-2-yl]-1H-indazole-6-carbonitrile.
| Compound Name | 3-[4-[(2-morpholin-4-ylethylamino)methyl]-1H-indol-2-yl]-1H-indazole-6-carbonitrile |
|---|---|
| PubChem CID | 135489341 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 3-[4-[(2-morpholin-4-ylethylamino)methyl]-1H-indol-2-yl]-1H-indazole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(-c3cc4c(CNCCN5CCOCC5)cccc4[nH]3)n[nH]c2c1 |
| InChI | InChI=1S/C23H24N6O/c24-14-16-4-5-18-21(12-16)27-28-23(18)22-13-19-17(2-1-3-20(19)26-22)15-25-6-7-29-8-10-30-11-9-29/h1-5,12-13,25-26H,6-11,15H2,(H,27,28) |
| InChIKey | UJYSADMJQWNDFF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|