C20H19N5O — CID 135491719
3-[4-[(2-methoxyethylamino)methyl]-1H-indol-2-yl]-1H-indazole-6-carbonitrile (PubChem CID 135491719) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-[4-[(2-methoxyethylamino)methyl]-1H-indol-2-yl]-1H-indazole-6-carbonitrile.
| Compound Name | 3-[4-[(2-methoxyethylamino)methyl]-1H-indol-2-yl]-1H-indazole-6-carbonitrile |
|---|---|
| PubChem CID | 135491719 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 3-[4-[(2-methoxyethylamino)methyl]-1H-indol-2-yl]-1H-indazole-6-carbonitrile |
| SMILES | COCCNCc1cccc2[nH]c(-c3n[nH]c4cc(C#N)ccc34)cc12 |
| InChI | InChI=1S/C20H19N5O/c1-26-8-7-22-12-14-3-2-4-17-16(14)10-19(23-17)20-15-6-5-13(11-21)9-18(15)24-25-20/h2-6,9-10,22-23H,7-8,12H2,1H3,(H,24,25) |
| InChIKey | OZMTUMAWDYVXLS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|