C24H22N4O3 — CID 135489974
2-(4-methoxyphenyl)-5-(4-nitrophenyl)-7-propan-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135489974) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-(4-nitrophenyl)-7-propan-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 2-(4-methoxyphenyl)-5-(4-nitrophenyl)-7-propan-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135489974 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-(4-nitrophenyl)-7-propan-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | COc1ccc(C2=Nc3ccc(C(C)C)cc3C(c3ccc([N+](=O)[O-])cc3)=NN2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-15(2)18-8-13-22-21(14-18)23(16-4-9-19(10-5-16)28(29)30)26-27-24(25-22)17-6-11-20(31-3)12-7-17/h4-15H,1-3H3,(H,25,27) |
| InChIKey | CCCPNOMXTWWLHO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|