C20H13BrN4O2 — CID 135417486
7-bromo-5-(4-nitrophenyl)-2-phenyl-3H-1,3,4-benzotriazepine (PubChem CID 135417486) has the molecular formula C20H13BrN4O2 and a molecular weight of 421.25 g/mol. Its IUPAC name is 7-bromo-5-(4-nitrophenyl)-2-phenyl-3H-1,3,4-benzotriazepine.
| Compound Name | 7-bromo-5-(4-nitrophenyl)-2-phenyl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135417486 |
| Molecular Formula | C20H13BrN4O2 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 7-bromo-5-(4-nitrophenyl)-2-phenyl-3H-1,3,4-benzotriazepine |
| SMILES | O=[N+]([O-])c1ccc(C2=NNC(c3ccccc3)=Nc3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C20H13BrN4O2/c21-15-8-11-18-17(12-15)19(13-6-9-16(10-7-13)25(26)27)23-24-20(22-18)14-4-2-1-3-5-14/h1-12H,(H,22,24) |
| InChIKey | PVDVWXUACDYFJW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|