C28H24N4O2 — CID 135408175
2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine (PubChem CID 135408175) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine.
| Compound Name | 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine |
|---|---|
| PubChem CID | 135408175 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine |
| SMILES | CC(C)(C)c1ccc(C2=Nc3c(ccc4ccccc34)C(c3ccc([N+](=O)[O-])cc3)=NN2)cc1 |
| InChI | InChI=1S/C28H24N4O2/c1-28(2,3)21-13-8-20(9-14-21)27-29-26-23-7-5-4-6-18(23)12-17-24(26)25(30-31-27)19-10-15-22(16-11-19)32(33)34/h4-17H,1-3H3,(H,29,31) |
| InChIKey | CCWCAPSBMAZHKI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|