About 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine
2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine (PubChem CID 135408175) has the molecular formula C28H24N4O2
and a molecular weight of 448.53 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine.
Molecular Properties
| Compound Name | 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine |
| PubChem CID | 135408175 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine |
| SMILES | CC(C)(C)c1ccc(C2=Nc3c(ccc4ccccc34)C(c3ccc([N+](=O)[O-])cc3)=NN2)cc1 |
| InChI | InChI=1S/C28H24N4O2/c1-28(2,3)21-13-8-20(9-14-21)27-29-26-23-7-5-4-6-18(23)12-17-24(26)25(30-31-27)19-10-15-22(16-11-19)32(33)34/h4-17H,1-3H3,(H,29,31) |
| InChIKey | CCWCAPSBMAZHKI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine?
The IUPAC name of 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine (CID 135408175) is 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine.
What is the SMILES notation for 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine?
The canonical SMILES for 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine is CC(C)(C)c1ccc(C2=Nc3c(ccc4ccccc34)C(c3ccc([N+](=O)[O-])cc3)=NN2)cc1.
What is the InChIKey of 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine?
The InChIKey is CCWCAPSBMAZHKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24N4O2/c1-28(2,3)21-13-8-20(9-14-21)27-29-26-23-7-5-4-6-18(23)12-17-24(26)25(30-31-27)19-10-15-22(16-11-19)32(33)34/h4-17H,1-3H3,(H,29,31).
What are the key properties of 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine?
2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine has a molecular weight of 448.53 g/mol, XLogP of 6.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butylphenyl)-5-(4-nitrophenyl)-3H-benzo[i][1,3,4]benzotriazepine is sourced from PubChem (CID 135408175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).