C28H28ClN5O6S — CID 135491819
3-[4-[(4-chlorophenyl)-[2-[(2-hydroxy-1H-indol-3-yl)diazenyl]-2-oxoethyl]sulfamoyl]phenyl]-N-(3-hydroxypropyl)propanamide (PubChem CID 135491819) has the molecular formula C28H28ClN5O6S and a molecular weight of 598.08 g/mol. Its IUPAC name is 3-[4-[(4-chlorophenyl)-[2-[(2-hydroxy-1H-indol-3-yl)diazenyl]-2-oxoethyl]sulfamoyl]phenyl]-N-(3-hydroxypropyl)propanamide.
| Compound Name | 3-[4-[(4-chlorophenyl)-[2-[(2-hydroxy-1H-indol-3-yl)diazenyl]-2-oxoethyl]sulfamoyl]phenyl]-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 135491819 |
| Molecular Formula | C28H28ClN5O6S |
| Molecular Weight | 598.08 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | 3-[4-[(4-chlorophenyl)-[2-[(2-hydroxy-1H-indol-3-yl)diazenyl]-2-oxoethyl]sulfamoyl]phenyl]-N-(3-hydroxypropyl)propanamide |
| SMILES | O=C(CN(c1ccc(Cl)cc1)S(=O)(=O)c1ccc(CCC(=O)NCCCO)cc1)/N=N/c1c(O)[nH]c2ccccc12 |
| InChI | InChI=1S/C28H28ClN5O6S/c29-20-9-11-21(12-10-20)34(18-26(37)32-33-27-23-4-1-2-5-24(23)31-28(27)38)41(39,40)22-13-6-19(7-14-22)8-15-25(36)30-16-3-17-35/h1-2,4-7,9-14,31,35,38H,3,8,15-18H2,(H,30,36)/b33-32+ |
| InChIKey | NDBQXMPCDLWLHI-ULIFNZDWSA-N |
| XLogP | 4.46 |
| TPSA | 164.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.08 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|