C21H28FN3O3S — CID 135496030
2-(4-fluorophenyl)-6-octylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135496030) has the molecular formula C21H28FN3O3S and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-octylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(4-fluorophenyl)-6-octylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135496030 |
| Molecular Formula | C21H28FN3O3S |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-(4-fluorophenyl)-6-octylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCCCCCCCS(=O)(=O)N1CCc2nc(-c3ccc(F)cc3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C21H28FN3O3S/c1-2-3-4-5-6-7-14-29(27,28)25-13-12-19-18(15-25)21(26)24-20(23-19)16-8-10-17(22)11-9-16/h8-11H,2-7,12-15H2,1H3,(H,23,24,26) |
| InChIKey | DXKSEEOJZJHURY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|