C26H30N6O12P2 — CID 135496778
[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3-(benzhydrylamino)-3-oxopropyl] hydrogen phosphate (PubChem CID 135496778) has the molecular formula C26H30N6O12P2 and a molecular weight of 680.50 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3-(benzhydrylamino)-3-oxopropyl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3-(benzhydrylamino)-3-oxopropyl] hydrogen phosphate |
|---|---|
| PubChem CID | 135496778 |
| Molecular Formula | C26H30N6O12P2 |
| Molecular Weight | 680.50 g/mol |
| Exact Mass | 680.14 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3-(benzhydrylamino)-3-oxopropyl] hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OCCC(=O)NC(c3ccccc3)c3ccccc3)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C26H30N6O12P2/c27-26-30-23-20(24(36)31-26)28-14-32(23)25-22(35)21(34)17(43-25)13-42-46(39,40)44-45(37,38)41-12-11-18(33)29-19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,14,17,19,21-22,25,34-35H,11-13H2,(H,29,33)(H,37,38)(H,39,40)(H3,27,30,31,36)/t17-,21-,22-,25-/m1/s1 |
| InChIKey | HGBPBOAGAIMIEV-XEWJDLBKSA-N |
| XLogP | 0.87 |
| TPSA | 270.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.50 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|