C28H33N7O15P2 — CID 135404887
[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3-(4-benzamido-2,5-dimethoxyanilino)-3-oxopropyl] hydrogen phosphate (PubChem CID 135404887) has the molecular formula C28H33N7O15P2 and a molecular weight of 769.55 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3-(4-benzamido-2,5-dimethoxyanilino)-3-oxopropyl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3-(4-benzamido-2,5-dimethoxyanilino)-3-oxopropyl] hydrogen phosphate |
|---|---|
| PubChem CID | 135404887 |
| Molecular Formula | C28H33N7O15P2 |
| Molecular Weight | 769.55 g/mol |
| Exact Mass | 769.15 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [3-(4-benzamido-2,5-dimethoxyanilino)-3-oxopropyl] hydrogen phosphate |
| SMILES | COc1cc(NC(=O)c2ccccc2)c(OC)cc1NC(=O)CCOP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H33N7O15P2/c1-45-17-11-16(32-25(39)14-6-4-3-5-7-14)18(46-2)10-15(17)31-20(36)8-9-47-51(41,42)50-52(43,44)48-12-19-22(37)23(38)27(49-19)35-13-30-21-24(35)33-28(29)34-26(21)40/h3-7,10-11,13,19,22-23,27,37-38H,8-9,12H2,1-2H3,(H,31,36)(H,32,39)(H,41,42)(H,43,44)(H3,29,33,34,40)/t19-,22-,23-,27-/m1/s1 |
| InChIKey | BDYQVTUBNHLPKA-CPLTYXLBSA-N |
| XLogP | 0.87 |
| TPSA | 318.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.55 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|