C27H32N6O12P2 — CID 135545241
[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [4-oxo-4-[(4-phenylphenyl)methylamino]butyl] hydrogen phosphate (PubChem CID 135545241) has the molecular formula C27H32N6O12P2 and a molecular weight of 694.53 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [4-oxo-4-[(4-phenylphenyl)methylamino]butyl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [4-oxo-4-[(4-phenylphenyl)methylamino]butyl] hydrogen phosphate |
|---|---|
| PubChem CID | 135545241 |
| Molecular Formula | C27H32N6O12P2 |
| Molecular Weight | 694.53 g/mol |
| Exact Mass | 694.16 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [4-oxo-4-[(4-phenylphenyl)methylamino]butyl] hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OCCCC(=O)NCc3ccc(-c4ccccc4)cc3)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C27H32N6O12P2/c28-27-31-24-21(25(37)32-27)30-15-33(24)26-23(36)22(35)19(44-26)14-43-47(40,41)45-46(38,39)42-12-4-7-20(34)29-13-16-8-10-18(11-9-16)17-5-2-1-3-6-17/h1-3,5-6,8-11,15,19,22-23,26,35-36H,4,7,12-14H2,(H,29,34)(H,38,39)(H,40,41)(H3,28,31,32,37)/t19-,22-,23-,26-/m1/s1 |
| InChIKey | RPRIABURVZBJQS-VJUOEERUSA-N |
| XLogP | 1.34 |
| TPSA | 270.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.53 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|