C32H34N6O12P2 — CID 135450899
[[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [5-oxo-5-(pyren-1-ylmethylamino)pentyl] hydrogen phosphate (PubChem CID 135450899) has the molecular formula C32H34N6O12P2 and a molecular weight of 756.60 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [5-oxo-5-(pyren-1-ylmethylamino)pentyl] hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [5-oxo-5-(pyren-1-ylmethylamino)pentyl] hydrogen phosphate |
|---|---|
| PubChem CID | 135450899 |
| Molecular Formula | C32H34N6O12P2 |
| Molecular Weight | 756.60 g/mol |
| Exact Mass | 756.17 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [5-oxo-5-(pyren-1-ylmethylamino)pentyl] hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OCCCCC(=O)NCc3ccc4ccc5cccc6ccc3c4c56)[C@@H](O)[C@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C32H34N6O12P2/c33-32-36-29-26(30(42)37-32)35-16-38(29)31-28(41)27(40)22(49-31)15-48-52(45,46)50-51(43,44)47-13-2-1-6-23(39)34-14-20-10-9-19-8-7-17-4-3-5-18-11-12-21(20)25(19)24(17)18/h3-5,7-12,16,22,27-28,31,40-41H,1-2,6,13-15H2,(H,34,39)(H,43,44)(H,45,46)(H3,33,36,37,42)/t22-,27-,28-,31-/m1/s1 |
| InChIKey | PKOMQOVYPBRAKJ-PVXRPORASA-N |
| XLogP | 2.96 |
| TPSA | 270.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.60 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|