C34H26N4O4 — CID 135496903
N-[[4-[2,4,5-tris[4-(hydroxyiminomethyl)phenyl]phenyl]phenyl]methylidene]hydroxylamine (PubChem CID 135496903) has the molecular formula C34H26N4O4 and a molecular weight of 554.61 g/mol. Its IUPAC name is N-[[4-[2,4,5-tris[4-(hydroxyiminomethyl)phenyl]phenyl]phenyl]methylidene]hydroxylamine.
| Compound Name | N-[[4-[2,4,5-tris[4-(hydroxyiminomethyl)phenyl]phenyl]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 135496903 |
| Molecular Formula | C34H26N4O4 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | N-[[4-[2,4,5-tris[4-(hydroxyiminomethyl)phenyl]phenyl]phenyl]methylidene]hydroxylamine |
| SMILES | ON=Cc1ccc(-c2cc(-c3ccc(C=NO)cc3)c(-c3ccc(C=NO)cc3)cc2-c2ccc(C=NO)cc2)cc1 |
| InChI | InChI=1S/C34H26N4O4/c39-35-19-23-1-9-27(10-2-23)31-17-33(29-13-5-25(6-14-29)21-37-41)34(30-15-7-26(8-16-30)22-38-42)18-32(31)28-11-3-24(4-12-28)20-36-40/h1-22,39-42H |
| InChIKey | PTEHTRMFBWWGSU-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|