C14H14N2O3 — CID 135498075
ethyl (5Z)-4-hydroxy-2-methyl-5-(pyridin-3-ylmethylidene)pyrrole-3-carboxylate (PubChem CID 135498075) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is ethyl (5Z)-4-hydroxy-2-methyl-5-(pyridin-3-ylmethylidene)pyrrole-3-carboxylate.
| Compound Name | ethyl (5Z)-4-hydroxy-2-methyl-5-(pyridin-3-ylmethylidene)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 135498075 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | ethyl (5Z)-4-hydroxy-2-methyl-5-(pyridin-3-ylmethylidene)pyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C/c2cccnc2)N=C1C |
| InChI | InChI=1S/C14H14N2O3/c1-3-19-14(18)12-9(2)16-11(13(12)17)7-10-5-4-6-15-8-10/h4-8,17H,3H2,1-2H3/b11-7- |
| InChIKey | FFMNJOIOAGKFDW-XFFZJAGNSA-N |
| XLogP | 2.27 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |