C22H25N7O4 — CID 135498819
(3E)-2-(4,6-dimethylpyrimidin-2-yl)-1-(4-ethoxyphenyl)-3-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]guanidine (PubChem CID 135498819) has the molecular formula C22H25N7O4 and a molecular weight of 451.49 g/mol. Its IUPAC name is (3E)-2-(4,6-dimethylpyrimidin-2-yl)-1-(4-ethoxyphenyl)-3-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]guanidine.
| Compound Name | (3E)-2-(4,6-dimethylpyrimidin-2-yl)-1-(4-ethoxyphenyl)-3-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]guanidine |
|---|---|
| PubChem CID | 135498819 |
| Molecular Formula | C22H25N7O4 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (3E)-2-(4,6-dimethylpyrimidin-2-yl)-1-(4-ethoxyphenyl)-3-[(4-hydroxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]guanidine |
| SMILES | CCOc1ccc(NC(/N=C/c2c(O)n(C)c(=O)n(C)c2=O)=N\c2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C22H25N7O4/c1-6-33-16-9-7-15(8-10-16)26-20(27-21-24-13(2)11-14(3)25-21)23-12-17-18(30)28(4)22(32)29(5)19(17)31/h7-12,30H,6H2,1-5H3,(H,24,25,26,27)/b23-12+ |
| InChIKey | IPYZDZAZPLWWRG-FSJBWODESA-N |
| XLogP | 1.81 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|