C27H26BrN3O4S — CID 135499637
6-bromo-3-[(2Z)-3-cyclohexyl-2-[(E)-(3-ethoxy-4-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 135499637) has the molecular formula C27H26BrN3O4S and a molecular weight of 568.49 g/mol. Its IUPAC name is 6-bromo-3-[(2Z)-3-cyclohexyl-2-[(E)-(3-ethoxy-4-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 6-bromo-3-[(2Z)-3-cyclohexyl-2-[(E)-(3-ethoxy-4-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 135499637 |
| Molecular Formula | C27H26BrN3O4S |
| Molecular Weight | 568.49 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | 6-bromo-3-[(2Z)-3-cyclohexyl-2-[(E)-(3-ethoxy-4-hydroxyphenyl)methylidenehydrazinylidene]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | CCOc1cc(/C=N/N=c2\scc(-c3cc4cc(Br)ccc4oc3=O)n2C2CCCCC2)ccc1O |
| InChI | InChI=1S/C27H26BrN3O4S/c1-2-34-25-12-17(8-10-23(25)32)15-29-30-27-31(20-6-4-3-5-7-20)22(16-36-27)21-14-18-13-19(28)9-11-24(18)35-26(21)33/h8-16,20,32H,2-7H2,1H3/b29-15+,30-27- |
| InChIKey | JSGDUBHXROLLBN-DZNKZYFNSA-N |
| XLogP | 6.63 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.49 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|