C26H24BrN3O4S — CID 135666355
6-bromo-3-[(2E)-3-cyclohexyl-2-[(Z)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 135666355) has the molecular formula C26H24BrN3O4S and a molecular weight of 554.47 g/mol. Its IUPAC name is 6-bromo-3-[(2E)-3-cyclohexyl-2-[(Z)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 6-bromo-3-[(2E)-3-cyclohexyl-2-[(Z)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 135666355 |
| Molecular Formula | C26H24BrN3O4S |
| Molecular Weight | 554.47 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | 6-bromo-3-[(2E)-3-cyclohexyl-2-[(Z)-(4-hydroxy-3-methoxyphenyl)methylidenehydrazinylidene]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | COc1cc(/C=N\N=c2\scc(-c3cc4cc(Br)ccc4oc3=O)n2C2CCCCC2)ccc1O |
| InChI | InChI=1S/C26H24BrN3O4S/c1-33-24-11-16(7-9-22(24)31)14-28-29-26-30(19-5-3-2-4-6-19)21(15-35-26)20-13-17-12-18(27)8-10-23(17)34-25(20)32/h7-15,19,31H,2-6H2,1H3/b28-14-,29-26+ |
| InChIKey | BVLPPJQXSYFTTN-GXBOUPNVSA-N |
| XLogP | 6.24 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|