C10H9N3O2S — CID 135501318
(1E)-1-(4-oxo-1,3-thiazolidin-2-ylidene)-3-phenylurea (PubChem CID 135501318) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is (1E)-1-(4-oxo-1,3-thiazolidin-2-ylidene)-3-phenylurea.
| Compound Name | (1E)-1-(4-oxo-1,3-thiazolidin-2-ylidene)-3-phenylurea |
|---|---|
| PubChem CID | 135501318 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | (1E)-1-(4-oxo-1,3-thiazolidin-2-ylidene)-3-phenylurea |
| SMILES | O=C1CS/C(=N/C(=O)Nc2ccccc2)N1 |
| InChI | InChI=1S/C10H9N3O2S/c14-8-6-16-10(12-8)13-9(15)11-7-4-2-1-3-5-7/h1-5H,6H2,(H2,11,12,13,14,15) |
| InChIKey | IMVXGSUDMYZKNK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|