C10H9ClN4O2S — CID 173343875
1-(4-chlorophenyl)-3-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]urea (PubChem CID 173343875) has the molecular formula C10H9ClN4O2S and a molecular weight of 284.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]urea |
|---|---|
| PubChem CID | 173343875 |
| Molecular Formula | C10H9ClN4O2S |
| Molecular Weight | 284.73 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]urea |
| SMILES | O=C1CS/C(=N/NC(=O)Nc2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C10H9ClN4O2S/c11-6-1-3-7(4-2-6)12-9(17)14-15-10-13-8(16)5-18-10/h1-4H,5H2,(H2,12,14,17)(H,13,15,16) |
| InChIKey | GQKWCSRQQLOIKZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.73 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|