C17H19ClN4O — CID 135967871
1-(4-chlorophenyl)-3-[(E)-(2,3-dimethyl-1,5,6,7-tetrahydroindol-4-ylidene)amino]urea (PubChem CID 135967871) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(E)-(2,3-dimethyl-1,5,6,7-tetrahydroindol-4-ylidene)amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(E)-(2,3-dimethyl-1,5,6,7-tetrahydroindol-4-ylidene)amino]urea |
|---|---|
| PubChem CID | 135967871 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(E)-(2,3-dimethyl-1,5,6,7-tetrahydroindol-4-ylidene)amino]urea |
| SMILES | Cc1[nH]c2c(c1C)/C(=N/NC(=O)Nc1ccc(Cl)cc1)CCC2 |
| InChI | InChI=1S/C17H19ClN4O/c1-10-11(2)19-14-4-3-5-15(16(10)14)21-22-17(23)20-13-8-6-12(18)7-9-13/h6-9,19H,3-5H2,1-2H3,(H2,20,22,23)/b21-15+ |
| InChIKey | CWWKNCKBBPUXKA-RCCKNPSSSA-N |
| XLogP | 4.15 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|