C8H14N4O2S — CID 173343831
1-butyl-3-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]urea (PubChem CID 173343831) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-butyl-3-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]urea.
| Compound Name | 1-butyl-3-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]urea |
|---|---|
| PubChem CID | 173343831 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-butyl-3-[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)amino]urea |
| SMILES | CCCCNC(=O)N/N=C1\NC(=O)CS1 |
| InChI | InChI=1S/C8H14N4O2S/c1-2-3-4-9-7(14)11-12-8-10-6(13)5-15-8/h2-5H2,1H3,(H2,9,11,14)(H,10,12,13) |
| InChIKey | RDCKRCBXCGDXBZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|