C14H15ClN4O4S — CID 154065909
[1-[4-chloro-3-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]anilino]-2-methyl-1-oxopropan-2-yl]carbamic acid (PubChem CID 154065909) has the molecular formula C14H15ClN4O4S and a molecular weight of 370.82 g/mol. Its IUPAC name is [1-[4-chloro-3-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]anilino]-2-methyl-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [1-[4-chloro-3-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]anilino]-2-methyl-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 154065909 |
| Molecular Formula | C14H15ClN4O4S |
| Molecular Weight | 370.82 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | [1-[4-chloro-3-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]anilino]-2-methyl-1-oxopropan-2-yl]carbamic acid |
| SMILES | CC(C)(NC(=O)O)C(=O)Nc1ccc(Cl)c(/N=C2\NC(=O)CS2)c1 |
| InChI | InChI=1S/C14H15ClN4O4S/c1-14(2,19-13(22)23)11(21)16-7-3-4-8(15)9(5-7)17-12-18-10(20)6-24-12/h3-5,19H,6H2,1-2H3,(H,16,21)(H,22,23)(H,17,18,20) |
| InChIKey | FAZBRGSUWVSUOW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 119.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|