C10H8N2O4S — CID 137163252
2-hydroxy-5-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoic acid (PubChem CID 137163252) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-hydroxy-5-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoic acid |
|---|---|
| PubChem CID | 137163252 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2-hydroxy-5-[(4-oxo-1,3-thiazolidin-2-ylidene)amino]benzoic acid |
| SMILES | O=C1CS/C(=N\c2ccc(O)c(C(=O)O)c2)N1 |
| InChI | InChI=1S/C10H8N2O4S/c13-7-2-1-5(3-6(7)9(15)16)11-10-12-8(14)4-17-10/h1-3,13H,4H2,(H,15,16)(H,11,12,14) |
| InChIKey | FEHCZVPFFRMBBI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 98.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|