C10H7FN2O2S — CID 154441871
3-fluoro-N-(4-oxo-1,3-thiazolidin-2-ylidene)benzamide (PubChem CID 154441871) has the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-fluoro-N-(4-oxo-1,3-thiazolidin-2-ylidene)benzamide.
| Compound Name | 3-fluoro-N-(4-oxo-1,3-thiazolidin-2-ylidene)benzamide |
|---|---|
| PubChem CID | 154441871 |
| Molecular Formula | C10H7FN2O2S |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 3-fluoro-N-(4-oxo-1,3-thiazolidin-2-ylidene)benzamide |
| SMILES | O=C1CS/C(=N/C(=O)c2cccc(F)c2)N1 |
| InChI | InChI=1S/C10H7FN2O2S/c11-7-3-1-2-6(4-7)9(15)13-10-12-8(14)5-16-10/h1-4H,5H2,(H,12,13,14,15) |
| InChIKey | QGSBBZDSEALRIK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|