C9H6F3N3O4 — CID 135501929
(NZ)-N-[(3Z)-1,1,1-trifluoro-3-hydroxyimino-3-(4-nitrophenyl)propan-2-ylidene]hydroxylamine (PubChem CID 135501929) has the molecular formula C9H6F3N3O4 and a molecular weight of 277.16 g/mol. Its IUPAC name is (NZ)-N-[(3Z)-1,1,1-trifluoro-3-hydroxyimino-3-(4-nitrophenyl)propan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(3Z)-1,1,1-trifluoro-3-hydroxyimino-3-(4-nitrophenyl)propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135501929 |
| Molecular Formula | C9H6F3N3O4 |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (NZ)-N-[(3Z)-1,1,1-trifluoro-3-hydroxyimino-3-(4-nitrophenyl)propan-2-ylidene]hydroxylamine |
| SMILES | O=[N+]([O-])c1ccc(C(=N/O)/C(=N/O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H6F3N3O4/c10-9(11,12)8(14-17)7(13-16)5-1-3-6(4-2-5)15(18)19/h1-4,16-17H/b13-7-,14-8- |
| InChIKey | ZLPSTZCVIKHHOE-PVRNWPCDSA-N |
| XLogP | 2.17 |
| TPSA | 108.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|