C12H15Cl2N3O2S — CID 135502259
1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea (PubChem CID 135502259) has the molecular formula C12H15Cl2N3O2S and a molecular weight of 336.24 g/mol. Its IUPAC name is 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 135502259 |
| Molecular Formula | C12H15Cl2N3O2S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)N/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H15Cl2N3O2S/c1-19-4-2-3-15-12(20)17-16-7-8-5-9(13)6-10(14)11(8)18/h5-7,18H,2-4H2,1H3,(H2,15,17,20)/b16-7+ |
| InChIKey | VORGXWCQEJRSQU-FRKPEAEDSA-N |
| XLogP | 2.53 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|