C31H38N2O11 — CID 135502347
(8S,10S)-8-(1,2-dihydroxyethyl)-6,8,11-trihydroxy-10-(5-hydroxy-6-methyl-4-morpholin-4-yloxan-2-yl)oxy-12-imino-1-methoxy-9,10-dihydro-7H-tetracen-5-one (PubChem CID 135502347) has the molecular formula C31H38N2O11 and a molecular weight of 614.65 g/mol. Its IUPAC name is (8S,10S)-8-(1,2-dihydroxyethyl)-6,8,11-trihydroxy-10-(5-hydroxy-6-methyl-4-morpholin-4-yloxan-2-yl)oxy-12-imino-1-methoxy-9,10-dihydro-7H-tetracen-5-one.
| Compound Name | (8S,10S)-8-(1,2-dihydroxyethyl)-6,8,11-trihydroxy-10-(5-hydroxy-6-methyl-4-morpholin-4-yloxan-2-yl)oxy-12-imino-1-methoxy-9,10-dihydro-7H-tetracen-5-one |
|---|---|
| PubChem CID | 135502347 |
| Molecular Formula | C31H38N2O11 |
| Molecular Weight | 614.65 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | (8S,10S)-8-(1,2-dihydroxyethyl)-6,8,11-trihydroxy-10-(5-hydroxy-6-methyl-4-morpholin-4-yloxan-2-yl)oxy-12-imino-1-methoxy-9,10-dihydro-7H-tetracen-5-one |
| SMILES | [H]/N=C1\c2c(OC)cccc2C(=O)c2c(O)c3c(c(O)c21)[C@@H](OC1CC(N2CCOCC2)C(O)C(C)O1)C[C@](O)(C(O)CO)C3 |
| InChI | InChI=1S/C31H38N2O11/c1-14-27(36)17(33-6-8-42-9-7-33)10-21(43-14)44-19-12-31(40,20(35)13-34)11-16-23(19)30(39)24-25(29(16)38)28(37)15-4-3-5-18(41-2)22(15)26(24)32/h3-5,14,17,19-21,27,32,34-36,38-40H,6-13H2,1-2H3/b32-26+/t14?,17?,19-,20?,21?,27?,31-/m0/s1 |
| InChIKey | NKENCCZPOLWWRP-JZUHIOKMSA-N |
| XLogP | 0.35 |
| TPSA | 202.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.65 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|