C13H10ClN3O3 — CID 135504515
6-chloro-2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid (PubChem CID 135504515) has the molecular formula C13H10ClN3O3 and a molecular weight of 291.69 g/mol. Its IUPAC name is 6-chloro-2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid.
| Compound Name | 6-chloro-2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 135504515 |
| Molecular Formula | C13H10ClN3O3 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 6-chloro-2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)nc1N/N=C/c1ccccc1O |
| InChI | InChI=1S/C13H10ClN3O3/c14-11-6-5-9(13(19)20)12(16-11)17-15-7-8-3-1-2-4-10(8)18/h1-7,18H,(H,16,17)(H,19,20)/b15-7+ |
| InChIKey | BWXZVGZIQMPZJG-VIZOYTHASA-N |
| XLogP | 2.58 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|