C12H11N3O3S — CID 153401692
5-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-1,2-thiazole-4-carboxylic acid (PubChem CID 153401692) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 5-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-1,2-thiazole-4-carboxylic acid.
| Compound Name | 5-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-1,2-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 153401692 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 5-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-1,2-thiazole-4-carboxylic acid |
| SMILES | Cc1nsc(NN=Cc2ccccc2O)c1C(=O)O |
| InChI | InChI=1S/C12H11N3O3S/c1-7-10(12(17)18)11(19-15-7)14-13-6-8-4-2-3-5-9(8)16/h2-6,14,16H,1H3,(H,17,18) |
| InChIKey | WKBCOZSJDAJOEZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|