C14H21NO4 — CID 135504798
tert-butyl (2S)-5-[(E)-2-hydroxy-4-oxopent-2-en-3-yl]-3,4-dihydro-2H-pyrrole-2-carboxylate (PubChem CID 135504798) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is tert-butyl (2S)-5-[(E)-2-hydroxy-4-oxopent-2-en-3-yl]-3,4-dihydro-2H-pyrrole-2-carboxylate.
| Compound Name | tert-butyl (2S)-5-[(E)-2-hydroxy-4-oxopent-2-en-3-yl]-3,4-dihydro-2H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 135504798 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | tert-butyl (2S)-5-[(E)-2-hydroxy-4-oxopent-2-en-3-yl]-3,4-dihydro-2H-pyrrole-2-carboxylate |
| SMILES | CC(=O)/C(C1=N[C@H](C(=O)OC(C)(C)C)CC1)=C(\C)O |
| InChI | InChI=1S/C14H21NO4/c1-8(16)12(9(2)17)10-6-7-11(15-10)13(18)19-14(3,4)5/h11,16H,6-7H2,1-5H3/b12-8-/t11-/m0/s1 |
| InChIKey | RJWWBENFSKCLJU-LCFDYFRESA-N |
| XLogP | 2.35 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|