C26H30FN5O3 — CID 135505832
2-amino-6-[5-(2-fluoro-4-methylanilino)-2-hydroxyphenyl]-N-(3-morpholin-4-ylpropyl)pyridine-3-carboxamide (PubChem CID 135505832) has the molecular formula C26H30FN5O3 and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-amino-6-[5-(2-fluoro-4-methylanilino)-2-hydroxyphenyl]-N-(3-morpholin-4-ylpropyl)pyridine-3-carboxamide.
| Compound Name | 2-amino-6-[5-(2-fluoro-4-methylanilino)-2-hydroxyphenyl]-N-(3-morpholin-4-ylpropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135505832 |
| Molecular Formula | C26H30FN5O3 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 2-amino-6-[5-(2-fluoro-4-methylanilino)-2-hydroxyphenyl]-N-(3-morpholin-4-ylpropyl)pyridine-3-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(O)c(-c3ccc(C(=O)NCCCN4CCOCC4)c(N)n3)c2)c(F)c1 |
| InChI | InChI=1S/C26H30FN5O3/c1-17-3-6-23(21(27)15-17)30-18-4-8-24(33)20(16-18)22-7-5-19(25(28)31-22)26(34)29-9-2-10-32-11-13-35-14-12-32/h3-8,15-16,30,33H,2,9-14H2,1H3,(H2,28,31)(H,29,34) |
| InChIKey | CWEXAWYTQUQCKH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|