C14H13ClN3O9PS — CID 135507286
4-chloro-3-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]benzenesulfonic acid (PubChem CID 135507286) has the molecular formula C14H13ClN3O9PS and a molecular weight of 465.76 g/mol. Its IUPAC name is 4-chloro-3-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-chloro-3-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 135507286 |
| Molecular Formula | C14H13ClN3O9PS |
| Molecular Weight | 465.76 g/mol |
| Exact Mass | 464.98 |
| IUPAC Name | 4-chloro-3-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonooxymethyl)-2-pyridinyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1nc(/N=N/c2cc(S(=O)(=O)O)ccc2Cl)c(COP(=O)(O)O)c(C=O)c1O |
| InChI | InChI=1S/C14H13ClN3O9PS/c1-7-13(20)9(5-19)10(6-27-28(21,22)23)14(16-7)18-17-12-4-8(29(24,25)26)2-3-11(12)15/h2-5,20H,6H2,1H3,(H2,21,22,23)(H,24,25,26)/b18-17+ |
| InChIKey | JNYMRYXWUVNWPM-ISLYRVAYSA-N |
| XLogP | 2.83 |
| TPSA | 196.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.76 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|