C14H14N3O11PS2 — CID 135544334
2-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonomethyl)-2-pyridinyl]diazenyl]benzene-1,4-disulfonic acid (PubChem CID 135544334) has the molecular formula C14H14N3O11PS2 and a molecular weight of 495.38 g/mol. Its IUPAC name is 2-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonomethyl)-2-pyridinyl]diazenyl]benzene-1,4-disulfonic acid.
| Compound Name | 2-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonomethyl)-2-pyridinyl]diazenyl]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 135544334 |
| Molecular Formula | C14H14N3O11PS2 |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.98 |
| IUPAC Name | 2-[[4-formyl-5-hydroxy-6-methyl-3-(phosphonomethyl)-2-pyridinyl]diazenyl]benzene-1,4-disulfonic acid |
| SMILES | Cc1nc(/N=N/c2cc(S(=O)(=O)O)ccc2S(=O)(=O)O)c(CP(=O)(O)O)c(C=O)c1O |
| InChI | InChI=1S/C14H14N3O11PS2/c1-7-13(19)9(5-18)10(6-29(20,21)22)14(15-7)17-16-11-4-8(30(23,24)25)2-3-12(11)31(26,27)28/h2-5,19H,6H2,1H3,(H2,20,21,22)(H,23,24,25)(H,26,27,28)/b17-16+ |
| InChIKey | BEUAGQZJDAPBKT-WUKNDPDISA-N |
| XLogP | 1.49 |
| TPSA | 241.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|