C23H17ClN4O — CID 135507658
2-[2-amino-4-(2-chloro-7-methylquinolin-3-yl)-6-(4-hydroxyphenyl)-3-pyridinyl]acetonitrile (PubChem CID 135507658) has the molecular formula C23H17ClN4O and a molecular weight of 400.87 g/mol. Its IUPAC name is 2-[2-amino-4-(2-chloro-7-methylquinolin-3-yl)-6-(4-hydroxyphenyl)-3-pyridinyl]acetonitrile.
| Compound Name | 2-[2-amino-4-(2-chloro-7-methylquinolin-3-yl)-6-(4-hydroxyphenyl)-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 135507658 |
| Molecular Formula | C23H17ClN4O |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[2-amino-4-(2-chloro-7-methylquinolin-3-yl)-6-(4-hydroxyphenyl)-3-pyridinyl]acetonitrile |
| SMILES | Cc1ccc2cc(-c3cc(-c4ccc(O)cc4)nc(N)c3CC#N)c(Cl)nc2c1 |
| InChI | InChI=1S/C23H17ClN4O/c1-13-2-3-15-11-19(22(24)27-20(15)10-13)18-12-21(14-4-6-16(29)7-5-14)28-23(26)17(18)8-9-25/h2-7,10-12,29H,8H2,1H3,(H2,26,28) |
| InChIKey | PUJIBTSQFFWIDR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|