C18H12Cl3NO2 — CID 2492029
(2-chloro-7-methylquinolin-3-yl)methyl 3,5-dichlorobenzoate (PubChem CID 2492029) has the molecular formula C18H12Cl3NO2 and a molecular weight of 380.66 g/mol. Its IUPAC name is (2-chloro-7-methylquinolin-3-yl)methyl 3,5-dichlorobenzoate.
| Compound Name | (2-chloro-7-methylquinolin-3-yl)methyl 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 2492029 |
| Molecular Formula | C18H12Cl3NO2 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 378.99 |
| IUPAC Name | (2-chloro-7-methylquinolin-3-yl)methyl 3,5-dichlorobenzoate |
| SMILES | Cc1ccc2cc(COC(=O)c3cc(Cl)cc(Cl)c3)c(Cl)nc2c1 |
| InChI | InChI=1S/C18H12Cl3NO2/c1-10-2-3-11-5-13(17(21)22-16(11)4-10)9-24-18(23)12-6-14(19)8-15(20)7-12/h2-8H,9H2,1H3 |
| InChIKey | GEDKJLPZCCERMX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|