C25H27ClN2O4 — CID 42985875
(2-chloro-7-methylquinolin-3-yl)methyl 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate (PubChem CID 42985875) has the molecular formula C25H27ClN2O4 and a molecular weight of 454.95 g/mol. Its IUPAC name is (2-chloro-7-methylquinolin-3-yl)methyl 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate.
| Compound Name | (2-chloro-7-methylquinolin-3-yl)methyl 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 42985875 |
| Molecular Formula | C25H27ClN2O4 |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | (2-chloro-7-methylquinolin-3-yl)methyl 2-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-4-methylpentanoate |
| SMILES | Cc1ccc2cc(COC(=O)C(CC(C)C)N3C(=O)C4CC=CCC4C3=O)c(Cl)nc2c1 |
| InChI | InChI=1S/C25H27ClN2O4/c1-14(2)10-21(28-23(29)18-6-4-5-7-19(18)24(28)30)25(31)32-13-17-12-16-9-8-15(3)11-20(16)27-22(17)26/h4-5,8-9,11-12,14,18-19,21H,6-7,10,13H2,1-3H3 |
| InChIKey | ZCLBHZFUZDSWMJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|