C26H25N5O6 — CID 135508142
(E)-N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-3-(4-methoxyphenyl)-2-phenylprop-2-enamide (PubChem CID 135508142) has the molecular formula C26H25N5O6 and a molecular weight of 503.52 g/mol. Its IUPAC name is (E)-N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-3-(4-methoxyphenyl)-2-phenylprop-2-enamide.
| Compound Name | (E)-N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-3-(4-methoxyphenyl)-2-phenylprop-2-enamide |
|---|---|
| PubChem CID | 135508142 |
| Molecular Formula | C26H25N5O6 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | (E)-N-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-3-(4-methoxyphenyl)-2-phenylprop-2-enamide |
| SMILES | COc1ccc(/C=C(/C(=O)Nc2nc3c(ncn3[C@H]3C[C@H](O)[C@@H](CO)O3)c(=O)[nH]2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N5O6/c1-36-17-9-7-15(8-10-17)11-18(16-5-3-2-4-6-16)24(34)29-26-28-23-22(25(35)30-26)27-14-31(23)21-12-19(33)20(13-32)37-21/h2-11,14,19-21,32-33H,12-13H2,1H3,(H2,28,29,30,34,35)/b18-11+/t19-,20+,21+/m0/s1 |
| InChIKey | KTCIBQACJSATRC-NNQJHPCXSA-N |
| XLogP | 1.95 |
| TPSA | 151.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|