C17H16N2O2 — CID 135512441
5-imino-1-(3-methoxyphenyl)-4-phenyl-2H-pyrrol-3-ol (PubChem CID 135512441) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-imino-1-(3-methoxyphenyl)-4-phenyl-2H-pyrrol-3-ol.
| Compound Name | 5-imino-1-(3-methoxyphenyl)-4-phenyl-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135512441 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-imino-1-(3-methoxyphenyl)-4-phenyl-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2ccccc2)=C(O)CN1c1cccc(OC)c1 |
| InChI | InChI=1S/C17H16N2O2/c1-21-14-9-5-8-13(10-14)19-11-15(20)16(17(19)18)12-6-3-2-4-7-12/h2-10,18,20H,11H2,1H3/b18-17- |
| InChIKey | HPOVUEXCVNHYDG-ZCXUNETKSA-N |
| XLogP | 3.46 |
| TPSA | 56.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|