C19H20N2O3 — CID 135415561
4-(3,4-dimethoxyphenyl)-5-imino-2-methyl-1-phenyl-2H-pyrrol-3-ol (PubChem CID 135415561) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-5-imino-2-methyl-1-phenyl-2H-pyrrol-3-ol.
| Compound Name | 4-(3,4-dimethoxyphenyl)-5-imino-2-methyl-1-phenyl-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135415561 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-5-imino-2-methyl-1-phenyl-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2ccc(OC)c(OC)c2)=C(O)C(C)N1c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3/c1-12-18(22)17(13-9-10-15(23-2)16(11-13)24-3)19(20)21(12)14-7-5-4-6-8-14/h4-12,20,22H,1-3H3/b20-19- |
| InChIKey | FDYUMFVCVYVNSS-VXPUYCOJSA-N |
| XLogP | 3.86 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|