C15H16N4O6 — CID 135513935
[(1R)-1-[(2S,3S,4R,5R)-5-(5-cyano-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]ethyl] acetate (PubChem CID 135513935) has the molecular formula C15H16N4O6 and a molecular weight of 348.32 g/mol. Its IUPAC name is [(1R)-1-[(2S,3S,4R,5R)-5-(5-cyano-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]ethyl] acetate.
| Compound Name | [(1R)-1-[(2S,3S,4R,5R)-5-(5-cyano-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 135513935 |
| Molecular Formula | C15H16N4O6 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | [(1R)-1-[(2S,3S,4R,5R)-5-(5-cyano-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]ethyl] acetate |
| SMILES | CC(=O)O[C@H](C)[C@H]1O[C@@H](n2cc(C#N)c3c(=O)[nH]cnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H16N4O6/c1-6(24-7(2)20)12-10(21)11(22)15(25-12)19-4-8(3-16)9-13(19)17-5-18-14(9)23/h4-6,10-12,15,21-22H,1-2H3,(H,17,18,23)/t6-,10+,11-,12-,15-/m1/s1 |
| InChIKey | MRGCQJVLSWGRLW-TVWFMYDNSA-N |
| XLogP | -0.83 |
| TPSA | 150.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |