C18H24N5O9P — CID 134823801
methyl 2-[[(2R,3S,4R,5R)-5-(4-amino-5-cyano-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-dimethoxyphosphorylacetate (PubChem CID 134823801) has the molecular formula C18H24N5O9P and a molecular weight of 485.39 g/mol. Its IUPAC name is methyl 2-[[(2R,3S,4R,5R)-5-(4-amino-5-cyano-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-dimethoxyphosphorylacetate.
| Compound Name | methyl 2-[[(2R,3S,4R,5R)-5-(4-amino-5-cyano-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-dimethoxyphosphorylacetate |
|---|---|
| PubChem CID | 134823801 |
| Molecular Formula | C18H24N5O9P |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | methyl 2-[[(2R,3S,4R,5R)-5-(4-amino-5-cyano-2-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-2-dimethoxyphosphorylacetate |
| SMILES | COC(=O)C(OC[C@H]1O[C@@H](n2cc(C#N)c3c(N)nc(C)nc32)[C@H](O)[C@@H]1O)P(=O)(OC)OC |
| InChI | InChI=1S/C18H24N5O9P/c1-8-21-14(20)11-9(5-19)6-23(15(11)22-8)16-13(25)12(24)10(32-16)7-31-18(17(26)28-2)33(27,29-3)30-4/h6,10,12-13,16,18,24-25H,7H2,1-4H3,(H2,20,21,22)/t10-,12-,13-,16-,18?/m1/s1 |
| InChIKey | VDLCGTDNMMBVIK-CMAHQRSQSA-N |
| XLogP | -0.19 |
| TPSA | 201.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|