C12H17N6O2+ — CID 135514971
3-N-[(3,4-dimethoxyphenyl)methylideneamino]-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine (PubChem CID 135514971) has the molecular formula C12H17N6O2+ and a molecular weight of 277.31 g/mol. Its IUPAC name is 3-N-[(3,4-dimethoxyphenyl)methylideneamino]-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine.
| Compound Name | 3-N-[(3,4-dimethoxyphenyl)methylideneamino]-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine |
|---|---|
| PubChem CID | 135514971 |
| Molecular Formula | C12H17N6O2+ |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3-N-[(3,4-dimethoxyphenyl)methylideneamino]-5-methyl-1H-1,2,4-triazol-4-ium-3,4-diamine |
| SMILES | COc1ccc(C=NNc2n[nH]c(C)[n+]2N)cc1OC |
| InChI | InChI=1S/C12H16N6O2/c1-8-15-17-12(18(8)13)16-14-7-9-4-5-10(19-2)11(6-9)20-3/h4-7H,13H2,1-3H3,(H,16,17)/p+1 |
| InChIKey | CEGOAIAVPHWYFD-UHFFFAOYSA-O |
| XLogP | 0.18 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|