About tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate
tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate (PubChem CID 135515172) has the molecular formula C23H26FN3O3
and a molecular weight of 411.48 g/mol. Its IUPAC name is tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate.
Molecular Properties
| Compound Name | tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate |
| PubChem CID | 135515172 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate |
| SMILES | Cc1nc2cc(C)c(CN(C)c3ccc(C(=O)OC(C)(C)C)c(F)c3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C23H26FN3O3/c1-13-9-20-18(21(28)26-14(2)25-20)10-15(13)12-27(6)16-7-8-17(19(24)11-16)22(29)30-23(3,4)5/h7-11H,12H2,1-6H3,(H,25,26,28) |
| InChIKey | VEOLSDGDGPAQJO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate?
The IUPAC name of tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate (CID 135515172) is tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate.
What is the SMILES notation for tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate?
The canonical SMILES for tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate is Cc1nc2cc(C)c(CN(C)c3ccc(C(=O)OC(C)(C)C)c(F)c3)cc2c(=O)[nH]1.
What is the InChIKey of tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate?
The InChIKey is VEOLSDGDGPAQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26FN3O3/c1-13-9-20-18(21(28)26-14(2)25-20)10-15(13)12-27(6)16-7-8-17(19(24)11-16)22(29)30-23(3,4)5/h7-11H,12H2,1-6H3,(H,25,26,28).
What are the key properties of tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate?
tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate has a molecular weight of 411.48 g/mol, XLogP of 4.27, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(2,7-dimethyl-4-oxo-3H-quinazolin-6-yl)methyl-methylamino]-2-fluorobenzoate is sourced from PubChem (CID 135515172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).