C21H23ClN4OS — CID 135515534
6-chloro-5-[2-[4-(2-sulfanylbenzenecarboximidoyl)piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one (PubChem CID 135515534) has the molecular formula C21H23ClN4OS and a molecular weight of 414.96 g/mol. Its IUPAC name is 6-chloro-5-[2-[4-(2-sulfanylbenzenecarboximidoyl)piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[2-[4-(2-sulfanylbenzenecarboximidoyl)piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 135515534 |
| Molecular Formula | C21H23ClN4OS |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 6-chloro-5-[2-[4-(2-sulfanylbenzenecarboximidoyl)piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one |
| SMILES | [H]/N=C(/c1ccccc1S)N1CCN(CCc2cc3c(cc2Cl)NC(=O)C3)CC1 |
| InChI | InChI=1S/C21H23ClN4OS/c22-17-13-18-15(12-20(27)24-18)11-14(17)5-6-25-7-9-26(10-8-25)21(23)16-3-1-2-4-19(16)28/h1-4,11,13,23,28H,5-10,12H2,(H,24,27)/b23-21- |
| InChIKey | KXOHAAHVVPKJFA-LNVKXUELSA-N |
| XLogP | 3.31 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|