C21H23ClN4OS — CID 59459708
5-[2-[4-(3a,7a-dihydro-1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 59459708) has the molecular formula C21H23ClN4OS and a molecular weight of 414.96 g/mol. Its IUPAC name is 5-[2-[4-(3a,7a-dihydro-1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-[4-(3a,7a-dihydro-1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 59459708 |
| Molecular Formula | C21H23ClN4OS |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 5-[2-[4-(3a,7a-dihydro-1,2-benzothiazol-3-yl)piperazin-1-yl]ethyl]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(CCN3CCN(C4=NSC5C=CC=CC45)CC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C21H23ClN4OS/c22-17-13-18-15(12-20(27)23-18)11-14(17)5-6-25-7-9-26(10-8-25)21-16-3-1-2-4-19(16)28-24-21/h1-4,11,13,16,19H,5-10,12H2,(H,23,27) |
| InChIKey | FZPIXVXHNWEAFQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|