C22H25ClN4OS — CID 169443573
6-chloro-5-[2-[4-[2-(trideuterio(113C)methylsulfanyl)benzenecarboximidoyl]piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one (PubChem CID 169443573) has the molecular formula C22H25ClN4OS and a molecular weight of 433.00 g/mol. Its IUPAC name is 6-chloro-5-[2-[4-[2-(trideuterio(113C)methylsulfanyl)benzenecarboximidoyl]piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-[2-[4-[2-(trideuterio(113C)methylsulfanyl)benzenecarboximidoyl]piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 169443573 |
| Molecular Formula | C22H25ClN4OS |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 6-chloro-5-[2-[4-[2-(trideuterio(113C)methylsulfanyl)benzenecarboximidoyl]piperazin-1-yl]ethyl]-1,3-dihydroindol-2-one |
| SMILES | [H]/N=C(/c1ccccc1S[13C]([2H])([2H])[2H])N1CCN(CCc2cc3c(cc2Cl)NC(=O)C3)CC1 |
| InChI | InChI=1S/C22H25ClN4OS/c1-29-20-5-3-2-4-17(20)22(24)27-10-8-26(9-11-27)7-6-15-12-16-13-21(28)25-19(16)14-18(15)23/h2-5,12,14,24H,6-11,13H2,1H3,(H,25,28)/b24-22-/i1+1D3 |
| InChIKey | NHUDBVVEHOSVCD-HLHXNAKLSA-N |
| XLogP | 3.74 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|