C29H40N4O3S — CID 123173384
(1R,7S)-4-[[2-[[4-(2-methylsulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10-triol (PubChem CID 123173384) has the molecular formula C29H40N4O3S and a molecular weight of 524.73 g/mol. Its IUPAC name is (1R,7S)-4-[[2-[[4-(2-methylsulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10-triol.
| Compound Name | (1R,7S)-4-[[2-[[4-(2-methylsulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10-triol |
|---|---|
| PubChem CID | 123173384 |
| Molecular Formula | C29H40N4O3S |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | (1R,7S)-4-[[2-[[4-(2-methylsulfanylbenzenecarboximidoyl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10-triol |
| SMILES | [H]/N=C(\c1ccccc1SC)N1CCN(CC2CCCCC2Cn2c(O)c3c(c2O)[C@@H]2CC[C@H]3C2O)CC1 |
| InChI | InChI=1S/C29H40N4O3S/c1-37-23-9-5-4-8-20(23)27(30)32-14-12-31(13-15-32)16-18-6-2-3-7-19(18)17-33-28(35)24-21-10-11-22(26(21)34)25(24)29(33)36/h4-5,8-9,18-19,21-22,26,30,34-36H,2-3,6-7,10-17H2,1H3/b30-27+/t18?,19?,21-,22+,26? |
| InChIKey | OVOCAOKENZUBCX-UHZOJURMSA-N |
| XLogP | 4.41 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|