C32H43N3O3 — CID 123173773
8-(hydroxymethyl)-4-[[(1R,2R)-2-[(4-indol-1-ylpiperidin-1-yl)methyl]cyclohexyl]methyl]-9-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol (PubChem CID 123173773) has the molecular formula C32H43N3O3 and a molecular weight of 517.71 g/mol. Its IUPAC name is 8-(hydroxymethyl)-4-[[(1R,2R)-2-[(4-indol-1-ylpiperidin-1-yl)methyl]cyclohexyl]methyl]-9-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol.
| Compound Name | 8-(hydroxymethyl)-4-[[(1R,2R)-2-[(4-indol-1-ylpiperidin-1-yl)methyl]cyclohexyl]methyl]-9-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 123173773 |
| Molecular Formula | C32H43N3O3 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.33 |
| IUPAC Name | 8-(hydroxymethyl)-4-[[(1R,2R)-2-[(4-indol-1-ylpiperidin-1-yl)methyl]cyclohexyl]methyl]-9-methyl-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol |
| SMILES | CC1C2CC(c3c2c(O)n(C[C@@H]2CCCC[C@H]2CN2CCC(n4ccc5ccccc54)CC2)c3O)C1CO |
| InChI | InChI=1S/C32H43N3O3/c1-20-25-16-26(27(20)19-36)30-29(25)31(37)35(32(30)38)18-23-8-3-2-7-22(23)17-33-13-11-24(12-14-33)34-15-10-21-6-4-5-9-28(21)34/h4-6,9-10,15,20,22-27,36-38H,2-3,7-8,11-14,16-19H2,1H3/t20?,22-,23-,25?,26?,27?/m0/s1 |
| InChIKey | MFDNTCGMJLPCJC-ZWYWHUQLSA-N |
| XLogP | 5.83 |
| TPSA | 73.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |