C16H22N2 — CID 43329408
(2-indol-1-ylcycloheptyl)methanamine (PubChem CID 43329408) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is (2-indol-1-ylcycloheptyl)methanamine.
| Compound Name | (2-indol-1-ylcycloheptyl)methanamine |
|---|---|
| PubChem CID | 43329408 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (2-indol-1-ylcycloheptyl)methanamine |
| SMILES | NCC1CCCCCC1n1ccc2ccccc21 |
| InChI | InChI=1S/C16H22N2/c17-12-14-7-2-1-3-8-16(14)18-11-10-13-6-4-5-9-15(13)18/h4-6,9-11,14,16H,1-3,7-8,12,17H2 |
| InChIKey | PWLBOMIQDZIGJR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |