C16H22N2 — CID 43329406
[2-(2-methylindol-1-yl)cyclohexyl]methanamine (PubChem CID 43329406) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is [2-(2-methylindol-1-yl)cyclohexyl]methanamine.
| Compound Name | [2-(2-methylindol-1-yl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 43329406 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | [2-(2-methylindol-1-yl)cyclohexyl]methanamine |
| SMILES | Cc1cc2ccccc2n1C1CCCCC1CN |
| InChI | InChI=1S/C16H22N2/c1-12-10-13-6-2-4-8-15(13)18(12)16-9-5-3-7-14(16)11-17/h2,4,6,8,10,14,16H,3,5,7,9,11,17H2,1H3 |
| InChIKey | HQNVACOTGZPNOK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |