C28H38N4O5S — CID 123316448
(1R,7S)-4-[[2-[[4-(1,1-dihydroxy-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10-triol (PubChem CID 123316448) has the molecular formula C28H38N4O5S and a molecular weight of 542.70 g/mol. Its IUPAC name is (1R,7S)-4-[[2-[[4-(1,1-dihydroxy-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10-triol.
| Compound Name | (1R,7S)-4-[[2-[[4-(1,1-dihydroxy-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10-triol |
|---|---|
| PubChem CID | 123316448 |
| Molecular Formula | C28H38N4O5S |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | (1R,7S)-4-[[2-[[4-(1,1-dihydroxy-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,10-triol |
| SMILES | Oc1c2c(c(O)n1CC1CCCCC1CN1CCN(C3=NS(O)(O)c4ccccc43)CC1)[C@@H]1CC[C@H]2C1O |
| InChI | InChI=1S/C28H38N4O5S/c33-25-20-9-10-21(25)24-23(20)27(34)32(28(24)35)16-18-6-2-1-5-17(18)15-30-11-13-31(14-12-30)26-19-7-3-4-8-22(19)38(36,37)29-26/h3-4,7-8,17-18,20-21,25,33-37H,1-2,5-6,9-16H2/t17?,18?,20-,21+,25? |
| InChIKey | JGGVLPRMJCBRHF-KRYHHIDYSA-N |
| XLogP | 4.14 |
| TPSA | 124.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |